C16H33N4OS+ — CID 7934164
1-(2,6-dimethylheptan-4-ylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934164) has the molecular formula C16H33N4OS+ and a molecular weight of 329.53 g/mol. Its IUPAC name is 1-(2,6-dimethylheptan-4-ylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(2,6-dimethylheptan-4-ylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934164 |
| Molecular Formula | C16H33N4OS+ |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 1-(2,6-dimethylheptan-4-ylideneamino)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CC(C)CC(CC(C)C)=NNC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C16H32N4OS/c1-13(2)11-15(12-14(3)4)18-19-16(22)17-5-6-20-7-9-21-10-8-20/h13-14H,5-12H2,1-4H3,(H2,17,19,22)/p+1 |
| InChIKey | QVACCQIFQIFWPO-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|