C16H21N3O2 — CID 79341766
(1-aminocycloheptyl)methyl N-(4-cyanophenyl)carbamate (PubChem CID 79341766) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1-aminocycloheptyl)methyl N-(4-cyanophenyl)carbamate.
| Compound Name | (1-aminocycloheptyl)methyl N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 79341766 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (1-aminocycloheptyl)methyl N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)OCC2(N)CCCCCC2)cc1 |
| InChI | InChI=1S/C16H21N3O2/c17-11-13-5-7-14(8-6-13)19-15(20)21-12-16(18)9-3-1-2-4-10-16/h5-8H,1-4,9-10,12,18H2,(H,19,20) |
| InChIKey | PHIRLNWEXJBECN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |