C13H12ClF3N2O2 — CID 79342747
5-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]-1H-indole-2,3-dione (PubChem CID 79342747) has the molecular formula C13H12ClF3N2O2 and a molecular weight of 320.70 g/mol. Its IUPAC name is 5-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79342747 |
| Molecular Formula | C13H12ClF3N2O2 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]-1H-indole-2,3-dione |
| SMILES | CCCN(CC(F)(F)F)c1cc2c(cc1Cl)C(=O)C(=O)N2 |
| InChI | InChI=1S/C13H12ClF3N2O2/c1-2-3-19(6-13(15,16)17)10-5-9-7(4-8(10)14)11(20)12(21)18-9/h4-5H,2-3,6H2,1H3,(H,18,20,21) |
| InChIKey | QNQOINOALLTGGL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|