C13H15ClF3N3O — CID 79342971
5-chloro-3-(ethylamino)-6-[methyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one (PubChem CID 79342971) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is 5-chloro-3-(ethylamino)-6-[methyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-(ethylamino)-6-[methyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79342971 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 5-chloro-3-(ethylamino)-6-[methyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2cc(N(C)CC(F)(F)F)c(Cl)cc21 |
| InChI | InChI=1S/C13H15ClF3N3O/c1-3-18-11-7-4-8(14)10(5-9(7)19-12(11)21)20(2)6-13(15,16)17/h4-5,11,18H,3,6H2,1-2H3,(H,19,21) |
| InChIKey | MTCBPPYUWSSZDP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|