C12H9BrN4O2S2 — CID 79343675
5-bromo-6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1H-indole-2,3-dione (PubChem CID 79343675) has the molecular formula C12H9BrN4O2S2 and a molecular weight of 385.27 g/mol. Its IUPAC name is 5-bromo-6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79343675 |
| Molecular Formula | C12H9BrN4O2S2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 5-bromo-6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1H-indole-2,3-dione |
| SMILES | CN(C)c1nnc(Sc2cc3c(cc2Br)C(=O)C(=O)N3)s1 |
| InChI | InChI=1S/C12H9BrN4O2S2/c1-17(2)11-15-16-12(21-11)20-8-4-7-5(3-6(8)13)9(18)10(19)14-7/h3-4H,1-2H3,(H,14,18,19) |
| InChIKey | WUKXIXPSZRHDKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|