About 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one
3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one (PubChem CID 79344342) has the molecular formula C14H9ClF2N2O2
and a molecular weight of 310.69 g/mol. Its IUPAC name is 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one |
| PubChem CID | 79344342 |
| Molecular Formula | C14H9ClF2N2O2 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one |
| SMILES | NC1C(=O)Nc2cc(Oc3ccc(F)cc3F)c(Cl)cc21 |
| InChI | InChI=1S/C14H9ClF2N2O2/c15-8-4-7-10(19-14(20)13(7)18)5-12(8)21-11-2-1-6(16)3-9(11)17/h1-5,13H,18H2,(H,19,20) |
| InChIKey | UUDPOVKHTOVRLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one?
The IUPAC name of 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one (CID 79344342) is 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one?
The canonical SMILES for 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one is NC1C(=O)Nc2cc(Oc3ccc(F)cc3F)c(Cl)cc21.
What is the InChIKey of 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one?
The InChIKey is UUDPOVKHTOVRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF2N2O2/c15-8-4-7-10(19-14(20)13(7)18)5-12(8)21-11-2-1-6(16)3-9(11)17/h1-5,13H,18H2,(H,19,20).
What are the key properties of 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one?
3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one has a molecular weight of 310.69 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-chloro-6-(2,4-difluorophenoxy)-1,3-dihydroindol-2-one is sourced from PubChem (CID 79344342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).