About 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one
5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79344367) has the molecular formula C14H8BrF2NO2S
and a molecular weight of 372.19 g/mol. Its IUPAC name is 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one |
| PubChem CID | 79344367 |
| Molecular Formula | C14H8BrF2NO2S |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(Sc3cc(F)ccc3F)c(Br)cc2C1O |
| InChI | InChI=1S/C14H8BrF2NO2S/c15-8-4-7-10(18-14(20)13(7)19)5-11(8)21-12-3-6(16)1-2-9(12)17/h1-5,13,19H,(H,18,20) |
| InChIKey | LJXLQWHBTLXQGO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one?
The IUPAC name of 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one (CID 79344367) is 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one?
The canonical SMILES for 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one is O=C1Nc2cc(Sc3cc(F)ccc3F)c(Br)cc2C1O.
What is the InChIKey of 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one?
The InChIKey is LJXLQWHBTLXQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF2NO2S/c15-8-4-7-10(18-14(20)13(7)19)5-11(8)21-12-3-6(16)1-2-9(12)17/h1-5,13,19H,(H,18,20).
What are the key properties of 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one?
5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one has a molecular weight of 372.19 g/mol, XLogP of 3.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(2,5-difluorophenyl)sulfanyl-3-hydroxy-1,3-dihydroindol-2-one is sourced from PubChem (CID 79344367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).