C14H17N3O3 — CID 79344960
5-(2-cyclopent-2-en-1-ylacetyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 79344960) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-(2-cyclopent-2-en-1-ylacetyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid.
| Compound Name | 5-(2-cyclopent-2-en-1-ylacetyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 79344960 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 5-(2-cyclopent-2-en-1-ylacetyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-6-carboxylic acid |
| SMILES | O=C(O)C1Cc2nc[nH]c2CN1C(=O)CC1C=CCC1 |
| InChI | InChI=1S/C14H17N3O3/c18-13(5-9-3-1-2-4-9)17-7-11-10(15-8-16-11)6-12(17)14(19)20/h1,3,8-9,12H,2,4-7H2,(H,15,16)(H,19,20) |
| InChIKey | AUDDHQYPPQSSOL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|