C13H21N3O2 — CID 79344975
4-methylpentyl 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 79344975) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-methylpentyl 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | 4-methylpentyl 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 79344975 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-methylpentyl 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | CC(C)CCCOC(=O)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C13H21N3O2/c1-9(2)4-3-5-18-13(17)11-6-10-12(7-14-11)16-8-15-10/h8-9,11,14H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | XAYDFFOQZOFJSB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|