C13H18FNO3 — CID 79346125
2-hydroxyethyl N-ethyl-N-[1-(4-fluorophenyl)ethyl]carbamate (PubChem CID 79346125) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-hydroxyethyl N-ethyl-N-[1-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-ethyl-N-[1-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 79346125 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-hydroxyethyl N-ethyl-N-[1-(4-fluorophenyl)ethyl]carbamate |
| SMILES | CCN(C(=O)OCCO)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO3/c1-3-15(13(17)18-9-8-16)10(2)11-4-6-12(14)7-5-11/h4-7,10,16H,3,8-9H2,1-2H3 |
| InChIKey | LLOUFFJFTQAFTI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |