C14H19NO4 — CID 79346417
2-hydroxyethyl N-(4-cyclopentyloxyphenyl)carbamate (PubChem CID 79346417) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-hydroxyethyl N-(4-cyclopentyloxyphenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(4-cyclopentyloxyphenyl)carbamate |
|---|---|
| PubChem CID | 79346417 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-hydroxyethyl N-(4-cyclopentyloxyphenyl)carbamate |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)OCCO |
| InChI | InChI=1S/C14H19NO4/c16-9-10-18-14(17)15-11-5-7-13(8-6-11)19-12-3-1-2-4-12/h5-8,12,16H,1-4,9-10H2,(H,15,17) |
| InChIKey | OUPFLLWSYHWDCV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |