About (3-aminocyclobutyl) N-cyclopropylcarbamate
(3-aminocyclobutyl) N-cyclopropylcarbamate (PubChem CID 79346679) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is (3-aminocyclobutyl) N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | (3-aminocyclobutyl) N-cyclopropylcarbamate |
| PubChem CID | 79346679 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3-aminocyclobutyl) N-cyclopropylcarbamate |
| SMILES | NC1CC(OC(=O)NC2CC2)C1 |
| InChI | InChI=1S/C8H14N2O2/c9-5-3-7(4-5)12-8(11)10-6-1-2-6/h5-7H,1-4,9H2,(H,10,11) |
| InChIKey | CFTSCLNQNRFWDD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-aminocyclobutyl) N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclobutyl) N-cyclopropylcarbamate?
The IUPAC name of (3-aminocyclobutyl) N-cyclopropylcarbamate (CID 79346679) is (3-aminocyclobutyl) N-cyclopropylcarbamate.
What is the SMILES notation for (3-aminocyclobutyl) N-cyclopropylcarbamate?
The canonical SMILES for (3-aminocyclobutyl) N-cyclopropylcarbamate is NC1CC(OC(=O)NC2CC2)C1.
What is the InChIKey of (3-aminocyclobutyl) N-cyclopropylcarbamate?
The InChIKey is CFTSCLNQNRFWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c9-5-3-7(4-5)12-8(11)10-6-1-2-6/h5-7H,1-4,9H2,(H,10,11).
What are the key properties of (3-aminocyclobutyl) N-cyclopropylcarbamate?
(3-aminocyclobutyl) N-cyclopropylcarbamate has a molecular weight of 170.21 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclobutyl) N-cyclopropylcarbamate is sourced from PubChem (CID 79346679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).