About 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate
2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate (PubChem CID 79346692) has the molecular formula C11H22N2O4
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate |
| PubChem CID | 79346692 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate |
| SMILES | CC(C)(CNC(=O)OCCO)N1CCOCC1 |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,13-3-6-16-7-4-13)9-12-10(15)17-8-5-14/h14H,3-9H2,1-2H3,(H,12,15) |
| InChIKey | JCFFWHCGKWTHIF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate?
The IUPAC name of 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate (CID 79346692) is 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate.
What is the SMILES notation for 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate?
The canonical SMILES for 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate is CC(C)(CNC(=O)OCCO)N1CCOCC1.
What is the InChIKey of 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate?
The InChIKey is JCFFWHCGKWTHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c1-11(2,13-3-6-16-7-4-13)9-12-10(15)17-8-5-14/h14H,3-9H2,1-2H3,(H,12,15).
What are the key properties of 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate?
2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate has a molecular weight of 246.31 g/mol, XLogP of -0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-(2-methyl-2-morpholin-4-ylpropyl)carbamate is sourced from PubChem (CID 79346692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).