About 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine
3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine (PubChem CID 79346821) has the molecular formula C12H15Cl2N
and a molecular weight of 244.17 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine |
| PubChem CID | 79346821 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine |
| SMILES | CCCNCC=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N/c1-2-7-15-8-3-4-10-5-6-11(13)12(14)9-10/h3-6,9,15H,2,7-8H2,1H3 |
| InChIKey | TVMAJGSKPSVOCQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine?
The IUPAC name of 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine (CID 79346821) is 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine?
The canonical SMILES for 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine is CCCNCC=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine?
The InChIKey is TVMAJGSKPSVOCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2N/c1-2-7-15-8-3-4-10-5-6-11(13)12(14)9-10/h3-6,9,15H,2,7-8H2,1H3.
What are the key properties of 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine?
3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine has a molecular weight of 244.17 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-N-propylprop-2-en-1-amine is sourced from PubChem (CID 79346821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).