About N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine
N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine (PubChem CID 79347050) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine |
| PubChem CID | 79347050 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine |
| SMILES | Cc1nn(C)c(C)c1C=CCNC(C)C |
| InChI | InChI=1S/C12H21N3/c1-9(2)13-8-6-7-12-10(3)14-15(5)11(12)4/h6-7,9,13H,8H2,1-5H3 |
| InChIKey | OARFOGKZHKNEMJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine?
The IUPAC name of N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine (CID 79347050) is N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine.
What is the SMILES notation for N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine?
The canonical SMILES for N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine is Cc1nn(C)c(C)c1C=CCNC(C)C.
What is the InChIKey of N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine?
The InChIKey is OARFOGKZHKNEMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-9(2)13-8-6-7-12-10(3)14-15(5)11(12)4/h6-7,9,13H,8H2,1-5H3.
What are the key properties of N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine?
N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine has a molecular weight of 207.32 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-en-1-amine is sourced from PubChem (CID 79347050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).