About 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine
3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine (PubChem CID 79347465) has the molecular formula C11H13F2N
and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine |
| PubChem CID | 79347465 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine |
| SMILES | CCNCC=Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2N/c1-2-14-7-3-4-9-5-6-10(12)11(13)8-9/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | VWMBUZSPJBVUGN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine?
The IUPAC name of 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine (CID 79347465) is 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine.
What is the SMILES notation for 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine?
The canonical SMILES for 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine is CCNCC=Cc1ccc(F)c(F)c1.
What is the InChIKey of 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine?
The InChIKey is VWMBUZSPJBVUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N/c1-2-14-7-3-4-9-5-6-10(12)11(13)8-9/h3-6,8,14H,2,7H2,1H3.
What are the key properties of 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine?
3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine has a molecular weight of 197.23 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-N-ethylprop-2-en-1-amine is sourced from PubChem (CID 79347465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).