C13H19N3S — CID 79347472
3-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-propylprop-2-en-1-amine (PubChem CID 79347472) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-propylprop-2-en-1-amine.
| Compound Name | 3-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79347472 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)-N-propylprop-2-en-1-amine |
| SMILES | CCCNCC=Cc1c(C)nc2scc(C)n12 |
| InChI | InChI=1S/C13H19N3S/c1-4-7-14-8-5-6-12-11(3)15-13-16(12)10(2)9-17-13/h5-6,9,14H,4,7-8H2,1-3H3 |
| InChIKey | QLRYVGRYAXUENB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|