C10H19NO3 — CID 79349145
2-hydroxyethyl 3,3-dimethylpiperidine-1-carboxylate (PubChem CID 79349145) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-hydroxyethyl 3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | 2-hydroxyethyl 3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 79349145 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-hydroxyethyl 3,3-dimethylpiperidine-1-carboxylate |
| SMILES | CC1(C)CCCN(C(=O)OCCO)C1 |
| InChI | InChI=1S/C10H19NO3/c1-10(2)4-3-5-11(8-10)9(13)14-7-6-12/h12H,3-8H2,1-2H3 |
| InChIKey | AQCZSKVHKZGUJW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |