2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate

C10H19NO4 — CID 79349518

IUPAC2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate
SMILESO=C(NCC1CCCCC1O)OCCO
InChIInChI=1S/C10H19NO4/c12-5-6-15-10(14)11-7-8-3-1-2-4-9(8)13/h8-9,12-13H,1-7H2,(H,11,14)
InChIKeyMHWZLOAAYXUIDI-UHFFFAOYSA-N
MW217.26 g/mol
LogP0.26
Rot. Bonds4

About 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate

2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate (PubChem CID 79349518) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate.

Molecular Properties

Compound Name2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate
PubChem CID79349518
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate
SMILESO=C(NCC1CCCCC1O)OCCO
InChIInChI=1S/C10H19NO4/c12-5-6-15-10(14)11-7-8-3-1-2-4-9(8)13/h8-9,12-13H,1-7H2,(H,11,14)
InChIKeyMHWZLOAAYXUIDI-UHFFFAOYSA-N
XLogP0.26
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.26
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate?
The IUPAC name of 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate (CID 79349518) is 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate.
What is the SMILES notation for 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate?
The canonical SMILES for 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate is O=C(NCC1CCCCC1O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate?
The InChIKey is MHWZLOAAYXUIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c12-5-6-15-10(14)11-7-8-3-1-2-4-9(8)13/h8-9,12-13H,1-7H2,(H,11,14).
What are the key properties of 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate?
2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate has a molecular weight of 217.26 g/mol, XLogP of 0.26, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-[(2-hydroxycyclohexyl)methyl]carbamate is sourced from PubChem (CID 79349518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).