C15H17NO2S — CID 79349643
1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 79349643) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79349643 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1C(=O)N(CC2CSc3ccccc32)C(=O)C1C |
| InChI | InChI=1S/C15H17NO2S/c1-9-10(2)15(18)16(14(9)17)7-11-8-19-13-6-4-3-5-12(11)13/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | VCODCVQBCZWNMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|