C10H21N3 — CID 79350044
2-methyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]guanidine (PubChem CID 79350044) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-methyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 79350044 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-methyl-1-[(2,2,3,3-tetramethylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(\N)NCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C10H21N3/c1-9(2)7(10(9,3)4)6-13-8(11)12-5/h7H,6H2,1-5H3,(H3,11,12,13) |
| InChIKey | ZHQNZVPVPUOBAW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|