C12H21NO3 — CID 79351134
ethyl 2-oxo-2-[(2,2,3,3-tetramethylcyclopropyl)methylamino]acetate (PubChem CID 79351134) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(2,2,3,3-tetramethylcyclopropyl)methylamino]acetate.
| Compound Name | ethyl 2-oxo-2-[(2,2,3,3-tetramethylcyclopropyl)methylamino]acetate |
|---|---|
| PubChem CID | 79351134 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | ethyl 2-oxo-2-[(2,2,3,3-tetramethylcyclopropyl)methylamino]acetate |
| SMILES | CCOC(=O)C(=O)NCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H21NO3/c1-6-16-10(15)9(14)13-7-8-11(2,3)12(8,4)5/h8H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | ZREZCSRHAXLTDX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|