C14H20F2N2 — CID 79352222
3,4-difluoro-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzene-1,2-diamine (PubChem CID 79352222) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is 3,4-difluoro-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 79352222 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3,4-difluoro-2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]benzene-1,2-diamine |
| SMILES | CC1(C)C(CNc2c(N)ccc(F)c2F)C1(C)C |
| InChI | InChI=1S/C14H20F2N2/c1-13(2)10(14(13,3)4)7-18-12-9(17)6-5-8(15)11(12)16/h5-6,10,18H,7,17H2,1-4H3 |
| InChIKey | KVONKEXKEPSYKS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|