C13H11F3N4O — CID 79352720
N-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 79352720) has the molecular formula C13H11F3N4O and a molecular weight of 296.25 g/mol. Its IUPAC name is N-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 79352720 |
| Molecular Formula | C13H11F3N4O |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C13H11F3N4O/c14-6-1-7(15)12(16)9(2-6)20-13(21)10-3-8-11(4-17-10)19-5-18-8/h1-2,5,10,17H,3-4H2,(H,18,19)(H,20,21) |
| InChIKey | WGNKXMKAHNAOPK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|