C10H14N6 — CID 79354580
6-(5-ethyl-1H-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (PubChem CID 79354580) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-(5-ethyl-1H-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
| Compound Name | 6-(5-ethyl-1H-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79354580 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-(5-ethyl-1H-1,2,4-triazol-3-yl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
| SMILES | CCc1nc(C2Cc3nc[nH]c3CN2)n[nH]1 |
| InChI | InChI=1S/C10H14N6/c1-2-9-14-10(16-15-9)7-3-6-8(4-11-7)13-5-12-6/h5,7,11H,2-4H2,1H3,(H,12,13)(H,14,15,16) |
| InChIKey | IZIMSPHSLMADMG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |