About 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one
5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one (PubChem CID 79354919) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one |
| PubChem CID | 79354919 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one |
| SMILES | Cc1cc(=O)n(CC(F)F)cc1N |
| InChI | InChI=1S/C8H10F2N2O/c1-5-2-8(13)12(3-6(5)11)4-7(9)10/h2-3,7H,4,11H2,1H3 |
| InChIKey | IKHAJSAEOMDGLH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one?
The IUPAC name of 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one (CID 79354919) is 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one.
What is the SMILES notation for 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one?
The canonical SMILES for 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one is Cc1cc(=O)n(CC(F)F)cc1N.
What is the InChIKey of 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one?
The InChIKey is IKHAJSAEOMDGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O/c1-5-2-8(13)12(3-6(5)11)4-7(9)10/h2-3,7H,4,11H2,1H3.
What are the key properties of 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one?
5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one has a molecular weight of 188.18 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(2,2-difluoroethyl)-4-methylpyridin-2-one is sourced from PubChem (CID 79354919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).