C13H21N3O2 — CID 79355641
2-(5-amino-4-methyl-2-oxo-1-pyridinyl)-N-(3-methylbutan-2-yl)acetamide (PubChem CID 79355641) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(5-amino-4-methyl-2-oxo-1-pyridinyl)-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(5-amino-4-methyl-2-oxo-1-pyridinyl)-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 79355641 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-(5-amino-4-methyl-2-oxo-1-pyridinyl)-N-(3-methylbutan-2-yl)acetamide |
| SMILES | Cc1cc(=O)n(CC(=O)NC(C)C(C)C)cc1N |
| InChI | InChI=1S/C13H21N3O2/c1-8(2)10(4)15-12(17)7-16-6-11(14)9(3)5-13(16)18/h5-6,8,10H,7,14H2,1-4H3,(H,15,17) |
| InChIKey | HTDPVAJOQKBDTB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |