C11H13Cl2N3OS — CID 79356095
4-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutan-2-ol (PubChem CID 79356095) has the molecular formula C11H13Cl2N3OS and a molecular weight of 306.22 g/mol. Its IUPAC name is 4-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutan-2-ol.
| Compound Name | 4-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 79356095 |
| Molecular Formula | C11H13Cl2N3OS |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 4-[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H13Cl2N3OS/c1-11(2,17)3-4-14-8-6(12)5-7(13)9-10(8)16-18-15-9/h5,14,17H,3-4H2,1-2H3 |
| InChIKey | JZWSEPXOTGELCZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |