C11H16FN3O2S — CID 79356866
ethyl 2-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetate (PubChem CID 79356866) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetate.
| Compound Name | ethyl 2-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 79356866 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | ethyl 2-fluoro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetate |
| SMILES | CCOC(=O)C(F)Sc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C11H16FN3O2S/c1-2-17-10(16)9(12)18-11-14-13-8-6-4-3-5-7-15(8)11/h9H,2-7H2,1H3 |
| InChIKey | XXZNFRBDFPTREI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |