About 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid (PubChem CID 79357057) has the molecular formula C6H7FN2O2S2
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid.
Molecular Properties
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid |
| PubChem CID | 79357057 |
| Molecular Formula | C6H7FN2O2S2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid |
| SMILES | Cc1nc(N)sc1SC(F)C(=O)O |
| InChI | InChI=1S/C6H7FN2O2S2/c1-2-5(13-6(8)9-2)12-3(7)4(10)11/h3H,1H3,(H2,8,9)(H,10,11) |
| InChIKey | CMBTZCUCYJBVQG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid?
The IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid (CID 79357057) is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid.
What is the SMILES notation for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid?
The canonical SMILES for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid is Cc1nc(N)sc1SC(F)C(=O)O.
What is the InChIKey of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid?
The InChIKey is CMBTZCUCYJBVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2O2S2/c1-2-5(13-6(8)9-2)12-3(7)4(10)11/h3H,1H3,(H2,8,9)(H,10,11).
What are the key properties of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid?
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid has a molecular weight of 222.27 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetic acid is sourced from PubChem (CID 79357057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).