2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid

C8H2Cl5FO3 — CID 79357320

IUPAC2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid
SMILESO=C(O)C(F)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl
InChIInChI=1S/C8H2Cl5FO3/c9-1-2(10)4(12)6(5(13)3(1)11)17-7(14)8(15)16/h7H,(H,15,16)
InChIKeyAGOKRWDJYJQHAK-UHFFFAOYSA-N
MW342.36 g/mol
LogP4.71
Rot. Bonds3

About 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid

2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid (PubChem CID 79357320) has the molecular formula C8H2Cl5FO3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid.

Molecular Properties

Compound Name2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid
PubChem CID79357320
Molecular FormulaC8H2Cl5FO3
Molecular Weight342.36 g/mol
Exact Mass339.84
IUPAC Name2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid
SMILESO=C(O)C(F)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl
InChIInChI=1S/C8H2Cl5FO3/c9-1-2(10)4(12)6(5(13)3(1)11)17-7(14)8(15)16/h7H,(H,15,16)
InChIKeyAGOKRWDJYJQHAK-UHFFFAOYSA-N
XLogP4.71
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.36
LogP ≤ 54.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid?
The IUPAC name of 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid (CID 79357320) is 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid.
What is the SMILES notation for 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid?
The canonical SMILES for 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid is O=C(O)C(F)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid?
The InChIKey is AGOKRWDJYJQHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl5FO3/c9-1-2(10)4(12)6(5(13)3(1)11)17-7(14)8(15)16/h7H,(H,15,16).
What are the key properties of 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid?
2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid has a molecular weight of 342.36 g/mol, XLogP of 4.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid is sourced from PubChem (CID 79357320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).