C8H2Cl5FO3 — CID 79357320
2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid (PubChem CID 79357320) has the molecular formula C8H2Cl5FO3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid.
| Compound Name | 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 79357320 |
| Molecular Formula | C8H2Cl5FO3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 339.84 |
| IUPAC Name | 2-fluoro-2-(2,3,4,5,6-pentachlorophenoxy)acetic acid |
| SMILES | O=C(O)C(F)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H2Cl5FO3/c9-1-2(10)4(12)6(5(13)3(1)11)17-7(14)8(15)16/h7H,(H,15,16) |
| InChIKey | AGOKRWDJYJQHAK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|