About 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid
2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid (PubChem CID 79357335) has the molecular formula C4H3FN2O2S2
and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid.
Molecular Properties
| Compound Name | 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid |
| PubChem CID | 79357335 |
| Molecular Formula | C4H3FN2O2S2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 193.96 |
| IUPAC Name | 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid |
| SMILES | O=C(O)C(F)Sc1nncs1 |
| InChI | InChI=1S/C4H3FN2O2S2/c5-2(3(8)9)11-4-7-6-1-10-4/h1-2H,(H,8,9) |
| InChIKey | YXARGMNNJVHMCJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid?
The IUPAC name of 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid (CID 79357335) is 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid.
What is the SMILES notation for 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid?
The canonical SMILES for 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid is O=C(O)C(F)Sc1nncs1.
What is the InChIKey of 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid?
The InChIKey is YXARGMNNJVHMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2O2S2/c5-2(3(8)9)11-4-7-6-1-10-4/h1-2H,(H,8,9).
What are the key properties of 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid?
2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid has a molecular weight of 194.21 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetic acid is sourced from PubChem (CID 79357335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).