About ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate
ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate (PubChem CID 79357619) has the molecular formula C8H11FN2O2S2
and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate |
| PubChem CID | 79357619 |
| Molecular Formula | C8H11FN2O2S2 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)Sc1sc(N)nc1C |
| InChI | InChI=1S/C8H11FN2O2S2/c1-3-13-6(12)5(9)14-7-4(2)11-8(10)15-7/h5H,3H2,1-2H3,(H2,10,11) |
| InChIKey | XJPMREDRPSBDIL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate?
The IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate (CID 79357619) is ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate.
What is the SMILES notation for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate?
The canonical SMILES for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate is CCOC(=O)C(F)Sc1sc(N)nc1C.
What is the InChIKey of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate?
The InChIKey is XJPMREDRPSBDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2S2/c1-3-13-6(12)5(9)14-7-4(2)11-8(10)15-7/h5H,3H2,1-2H3,(H2,10,11).
What are the key properties of ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate?
ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate has a molecular weight of 250.32 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-2-fluoroacetate is sourced from PubChem (CID 79357619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).