C12H22ClNO — CID 79358044
3-chloro-2-methyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]propanamide (PubChem CID 79358044) has the molecular formula C12H22ClNO and a molecular weight of 231.77 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]propanamide.
| Compound Name | 3-chloro-2-methyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]propanamide |
|---|---|
| PubChem CID | 79358044 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-chloro-2-methyl-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]propanamide |
| SMILES | CC(CCl)C(=O)NCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H22ClNO/c1-8(6-13)10(15)14-7-9-11(2,3)12(9,4)5/h8-9H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | UUOAWIMMVIBGJD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|