C16H22N4 — CID 79359942
N-ethyl-4-methyl-N-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-6-ylmethyl)aniline (PubChem CID 79359942) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-6-ylmethyl)aniline.
| Compound Name | N-ethyl-4-methyl-N-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-6-ylmethyl)aniline |
|---|---|
| PubChem CID | 79359942 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N-ethyl-4-methyl-N-(4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-6-ylmethyl)aniline |
| SMILES | CCN(CC1Cc2nc[nH]c2CN1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22N4/c1-3-20(14-6-4-12(2)5-7-14)10-13-8-15-16(9-17-13)19-11-18-15/h4-7,11,13,17H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | IGKLVDXRAOBDRS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|