C16H23N5 — CID 79361312
3-methyl-4-[1-[(2,2,3,3-tetramethylcyclopropyl)methyl]tetrazol-5-yl]aniline (PubChem CID 79361312) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 3-methyl-4-[1-[(2,2,3,3-tetramethylcyclopropyl)methyl]tetrazol-5-yl]aniline.
| Compound Name | 3-methyl-4-[1-[(2,2,3,3-tetramethylcyclopropyl)methyl]tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 79361312 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3-methyl-4-[1-[(2,2,3,3-tetramethylcyclopropyl)methyl]tetrazol-5-yl]aniline |
| SMILES | Cc1cc(N)ccc1-c1nnnn1CC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C16H23N5/c1-10-8-11(17)6-7-12(10)14-18-19-20-21(14)9-13-15(2,3)16(13,4)5/h6-8,13H,9,17H2,1-5H3 |
| InChIKey | SBFHQXIJXGYXAS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|