About 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol
4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol (PubChem CID 79361324) has the molecular formula C9H19NO3S
and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol |
| PubChem CID | 79361324 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO3S/c1-9(2,11)3-4-10-5-7-14(12,13)8-6-10/h11H,3-8H2,1-2H3 |
| InChIKey | MQZBOQRHTZEWOK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol?
The IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol (CID 79361324) is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol.
What is the SMILES notation for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol?
The canonical SMILES for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol is CC(C)(O)CCN1CCS(=O)(=O)CC1.
What is the InChIKey of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol?
The InChIKey is MQZBOQRHTZEWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S/c1-9(2,11)3-4-10-5-7-14(12,13)8-6-10/h11H,3-8H2,1-2H3.
What are the key properties of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol?
4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol has a molecular weight of 221.32 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylbutan-2-ol is sourced from PubChem (CID 79361324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).