C19H30N2 — CID 79361327
5-ethyl-2-phenyl-1-(2,2,3,3-tetramethylcyclopropyl)piperazine (PubChem CID 79361327) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 5-ethyl-2-phenyl-1-(2,2,3,3-tetramethylcyclopropyl)piperazine.
| Compound Name | 5-ethyl-2-phenyl-1-(2,2,3,3-tetramethylcyclopropyl)piperazine |
|---|---|
| PubChem CID | 79361327 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 5-ethyl-2-phenyl-1-(2,2,3,3-tetramethylcyclopropyl)piperazine |
| SMILES | CCC1CN(C2C(C)(C)C2(C)C)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C19H30N2/c1-6-15-13-21(17-18(2,3)19(17,4)5)16(12-20-15)14-10-8-7-9-11-14/h7-11,15-17,20H,6,12-13H2,1-5H3 |
| InChIKey | NGYSNWIPFGKGHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |