C11H22N2O2S2 — CID 79362637
2-[(2,2,3,3-tetramethylcyclopropyl)methylsulfamoyl]propanethioamide (PubChem CID 79362637) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetramethylcyclopropyl)methylsulfamoyl]propanethioamide.
| Compound Name | 2-[(2,2,3,3-tetramethylcyclopropyl)methylsulfamoyl]propanethioamide |
|---|---|
| PubChem CID | 79362637 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[(2,2,3,3-tetramethylcyclopropyl)methylsulfamoyl]propanethioamide |
| SMILES | CC(C(N)=S)S(=O)(=O)NCC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C11H22N2O2S2/c1-7(9(12)16)17(14,15)13-6-8-10(2,3)11(8,4)5/h7-8,13H,6H2,1-5H3,(H2,12,16) |
| InChIKey | RNZZITYRYAAVIV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|