C11H15N3O2S — CID 79363726
3-[(4-acetyl-3-methyl-1,2-thiazol-5-yl)amino]piperidin-2-one (PubChem CID 79363726) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 3-[(4-acetyl-3-methyl-1,2-thiazol-5-yl)amino]piperidin-2-one.
| Compound Name | 3-[(4-acetyl-3-methyl-1,2-thiazol-5-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 79363726 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[(4-acetyl-3-methyl-1,2-thiazol-5-yl)amino]piperidin-2-one |
| SMILES | CC(=O)c1c(C)nsc1NC1CCCNC1=O |
| InChI | InChI=1S/C11H15N3O2S/c1-6-9(7(2)15)11(17-14-6)13-8-4-3-5-12-10(8)16/h8,13H,3-5H2,1-2H3,(H,12,16) |
| InChIKey | RGGCBSQSLRUHBT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |