About [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol
[2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol (PubChem CID 79364602) has the molecular formula C13H15BrO4
and a molecular weight of 315.16 g/mol. Its IUPAC name is [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol |
| PubChem CID | 79364602 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol |
| SMILES | OCC1CCOC1c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C13H15BrO4/c14-10-5-9(12-8(7-15)1-2-17-12)6-11-13(10)18-4-3-16-11/h5-6,8,12,15H,1-4,7H2 |
| InChIKey | CRIRYZAOMPGSPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol?
The IUPAC name of [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol (CID 79364602) is [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol.
What is the SMILES notation for [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol?
The canonical SMILES for [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol is OCC1CCOC1c1cc(Br)c2c(c1)OCCO2.
What is the InChIKey of [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol?
The InChIKey is CRIRYZAOMPGSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO4/c14-10-5-9(12-8(7-15)1-2-17-12)6-11-13(10)18-4-3-16-11/h5-6,8,12,15H,1-4,7H2.
What are the key properties of [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol?
[2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol has a molecular weight of 315.16 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)oxolan-3-yl]methanol is sourced from PubChem (CID 79364602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).