C13H19NO3 — CID 79365049
2-(3,4-dimethoxyphenyl)oxan-3-amine (PubChem CID 79365049) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)oxan-3-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)oxan-3-amine |
|---|---|
| PubChem CID | 79365049 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)oxan-3-amine |
| SMILES | COc1ccc(C2OCCCC2N)cc1OC |
| InChI | InChI=1S/C13H19NO3/c1-15-11-6-5-9(8-12(11)16-2)13-10(14)4-3-7-17-13/h5-6,8,10,13H,3-4,7,14H2,1-2H3 |
| InChIKey | FZXALCYAKIBKMX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |