C15H21Cl2NO2 — CID 79365400
N-[[2-(2,6-dichlorophenyl)oxan-3-yl]methyl]-2-methoxyethanamine (PubChem CID 79365400) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is N-[[2-(2,6-dichlorophenyl)oxan-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(2,6-dichlorophenyl)oxan-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79365400 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[[2-(2,6-dichlorophenyl)oxan-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1CCCOC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H21Cl2NO2/c1-19-9-7-18-10-11-4-3-8-20-15(11)14-12(16)5-2-6-13(14)17/h2,5-6,11,15,18H,3-4,7-10H2,1H3 |
| InChIKey | NMSFAGZFCXJSRF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|