About [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol
[2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol (PubChem CID 79365790) has the molecular formula C11H16O2S
and a molecular weight of 212.31 g/mol. Its IUPAC name is [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol |
| PubChem CID | 79365790 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol |
| SMILES | Cc1cc(C2OCCC2CO)c(C)s1 |
| InChI | InChI=1S/C11H16O2S/c1-7-5-10(8(2)14-7)11-9(6-12)3-4-13-11/h5,9,11-12H,3-4,6H2,1-2H3 |
| InChIKey | XMOILNBCOMTUAG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol?
The IUPAC name of [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol (CID 79365790) is [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol.
What is the SMILES notation for [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol?
The canonical SMILES for [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol is Cc1cc(C2OCCC2CO)c(C)s1.
What is the InChIKey of [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol?
The InChIKey is XMOILNBCOMTUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S/c1-7-5-10(8(2)14-7)11-9(6-12)3-4-13-11/h5,9,11-12H,3-4,6H2,1-2H3.
What are the key properties of [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol?
[2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol has a molecular weight of 212.31 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylthiophen-3-yl)oxolan-3-yl]methanol is sourced from PubChem (CID 79365790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).