C16H25NO — CID 79365813
N-[[2-(2,3-dimethylphenyl)oxan-3-yl]methyl]ethanamine (PubChem CID 79365813) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[[2-(2,3-dimethylphenyl)oxan-3-yl]methyl]ethanamine.
| Compound Name | N-[[2-(2,3-dimethylphenyl)oxan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 79365813 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[[2-(2,3-dimethylphenyl)oxan-3-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCOC1c1cccc(C)c1C |
| InChI | InChI=1S/C16H25NO/c1-4-17-11-14-8-6-10-18-16(14)15-9-5-7-12(2)13(15)3/h5,7,9,14,16-17H,4,6,8,10-11H2,1-3H3 |
| InChIKey | PFGRJDQVWCJWPQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |