C20H24N2O4 — CID 7936687
N-[2-(4-methoxyanilino)-2-oxoethyl]-3-(4-methoxyphenyl)-N-methylpropanamide (PubChem CID 7936687) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[2-(4-methoxyanilino)-2-oxoethyl]-3-(4-methoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[2-(4-methoxyanilino)-2-oxoethyl]-3-(4-methoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 7936687 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[2-(4-methoxyanilino)-2-oxoethyl]-3-(4-methoxyphenyl)-N-methylpropanamide |
| SMILES | COc1ccc(CCC(=O)N(C)CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-22(14-19(23)21-16-7-11-18(26-3)12-8-16)20(24)13-6-15-4-9-17(25-2)10-5-15/h4-5,7-12H,6,13-14H2,1-3H3,(H,21,23) |
| InChIKey | VMRUYEQQRAEEKB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |