About 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid
1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 79369732) has the molecular formula C9H12N4O4
and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid |
| PubChem CID | 79369732 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1C(C(=O)O)CCN1C(=O)c1nonc1N |
| InChI | InChI=1S/C9H12N4O4/c1-4-5(9(15)16)2-3-13(4)8(14)6-7(10)12-17-11-6/h4-5H,2-3H2,1H3,(H2,10,12)(H,15,16) |
| InChIKey | BAXDUIQYAILSPW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid (CID 79369732) is 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid is CC1C(C(=O)O)CCN1C(=O)c1nonc1N.
What is the InChIKey of 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid?
The InChIKey is BAXDUIQYAILSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O4/c1-4-5(9(15)16)2-3-13(4)8(14)6-7(10)12-17-11-6/h4-5H,2-3H2,1H3,(H2,10,12)(H,15,16).
What are the key properties of 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid?
1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid has a molecular weight of 240.22 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,2,5-oxadiazole-3-carbonyl)-2-methylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 79369732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).