C16H14F3NO — CID 79370051
6-methoxy-N-(3,4,5-trifluorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 79370051) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is 6-methoxy-N-(3,4,5-trifluorophenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-methoxy-N-(3,4,5-trifluorophenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 79370051 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 6-methoxy-N-(3,4,5-trifluorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1ccc2c(c1)C(Nc1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C16H14F3NO/c1-21-11-4-2-9-3-5-15(12(9)8-11)20-10-6-13(17)16(19)14(18)7-10/h2,4,6-8,15,20H,3,5H2,1H3 |
| InChIKey | ZFEUJWDKDKMYPG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|