C16H25NO4 — CID 79370684
N-[[2-(3,5-dimethoxyphenyl)oxolan-3-yl]methyl]-2-methoxyethanamine (PubChem CID 79370684) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[[2-(3,5-dimethoxyphenyl)oxolan-3-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(3,5-dimethoxyphenyl)oxolan-3-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79370684 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[[2-(3,5-dimethoxyphenyl)oxolan-3-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCC1CCOC1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C16H25NO4/c1-18-7-5-17-11-12-4-6-21-16(12)13-8-14(19-2)10-15(9-13)20-3/h8-10,12,16-17H,4-7,11H2,1-3H3 |
| InChIKey | QODSNXLZZGHEJN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|