About 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid
2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 79371346) has the molecular formula C10H16F3NO3
and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 79371346 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1C(C(=O)O)CCN1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c1-7-8(9(15)16)2-3-14(7)4-5-17-6-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16) |
| InChIKey | UCFOIGKUMMQFHP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid (CID 79371346) is 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid is CC1C(C(=O)O)CCN1CCOCC(F)(F)F.
What is the InChIKey of 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid?
The InChIKey is UCFOIGKUMMQFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO3/c1-7-8(9(15)16)2-3-14(7)4-5-17-6-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16).
What are the key properties of 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid?
2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid has a molecular weight of 255.24 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 79371346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).